About 2-methyltricosane;hydrate
2-methyltricosane;hydrate (PubChem CID 172783998) has the molecular formula C24H52O
and a molecular weight of 356.68 g/mol. Its IUPAC name is 2-methyltricosane;hydrate.
Molecular Properties
| Compound Name | 2-methyltricosane;hydrate |
| PubChem CID | 172783998 |
| Molecular Formula | C24H52O |
| Molecular Weight | 356.68 g/mol |
| Exact Mass | 356.40 |
| IUPAC Name | 2-methyltricosane;hydrate |
| SMILES | CCCCCCCCCCCCCCCCCCCCCC(C)C.O |
| InChI | InChI=1S/C24H50.H2O/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24(2)3;/h24H,4-23H2,1-3H3;1H2 |
| InChIKey | UJVOWGAGMQPSMN-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.68 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyltricosane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyltricosane;hydrate?
The IUPAC name of 2-methyltricosane;hydrate (CID 172783998) is 2-methyltricosane;hydrate.
What is the SMILES notation for 2-methyltricosane;hydrate?
The canonical SMILES for 2-methyltricosane;hydrate is CCCCCCCCCCCCCCCCCCCCCC(C)C.O.
What is the InChIKey of 2-methyltricosane;hydrate?
The InChIKey is UJVOWGAGMQPSMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H50.H2O/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24(2)3;/h24H,4-23H2,1-3H3;1H2.
What are the key properties of 2-methyltricosane;hydrate?
2-methyltricosane;hydrate has a molecular weight of 356.68 g/mol, XLogP of 8.64, 20 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyltricosane;hydrate is sourced from PubChem (CID 172783998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).