About 2-methylheptadecane;hydrobromide
2-methylheptadecane;hydrobromide (PubChem CID 174866228) has the molecular formula C18H39Br
and a molecular weight of 335.41 g/mol. Its IUPAC name is 2-methylheptadecane;hydrobromide.
Molecular Properties
| Compound Name | 2-methylheptadecane;hydrobromide |
| PubChem CID | 174866228 |
| Molecular Formula | C18H39Br |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | 2-methylheptadecane;hydrobromide |
| SMILES | Br.CCCCCCCCCCCCCCCC(C)C |
| InChI | InChI=1S/C18H38.BrH/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(2)3;/h18H,4-17H2,1-3H3;1H |
| InChIKey | YVBBLRXDVBKITE-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methylheptadecane;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylheptadecane;hydrobromide?
The IUPAC name of 2-methylheptadecane;hydrobromide (CID 174866228) is 2-methylheptadecane;hydrobromide.
What is the SMILES notation for 2-methylheptadecane;hydrobromide?
The canonical SMILES for 2-methylheptadecane;hydrobromide is Br.CCCCCCCCCCCCCCCC(C)C.
What is the InChIKey of 2-methylheptadecane;hydrobromide?
The InChIKey is YVBBLRXDVBKITE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38.BrH/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(2)3;/h18H,4-17H2,1-3H3;1H.
What are the key properties of 2-methylheptadecane;hydrobromide?
2-methylheptadecane;hydrobromide has a molecular weight of 335.41 g/mol, XLogP of 7.70, 14 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylheptadecane;hydrobromide is sourced from PubChem (CID 174866228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).