About azane;2-methyloctadecane
azane;2-methyloctadecane (PubChem CID 175414560) has the molecular formula C19H43N
and a molecular weight of 285.56 g/mol. Its IUPAC name is azane;2-methyloctadecane.
Molecular Properties
| Compound Name | azane;2-methyloctadecane |
| PubChem CID | 175414560 |
| Molecular Formula | C19H43N |
| Molecular Weight | 285.56 g/mol |
| Exact Mass | 285.34 |
| IUPAC Name | azane;2-methyloctadecane |
| SMILES | CCCCCCCCCCCCCCCCC(C)C.N |
| InChI | InChI=1S/C19H40.H3N/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2)3;/h19H,4-18H2,1-3H3;1H3 |
| InChIKey | ISYAHSXSKGMDFM-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 285.56 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze azane;2-methyloctadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-methyloctadecane?
The IUPAC name of azane;2-methyloctadecane (CID 175414560) is azane;2-methyloctadecane.
What is the SMILES notation for azane;2-methyloctadecane?
The canonical SMILES for azane;2-methyloctadecane is CCCCCCCCCCCCCCCCC(C)C.N.
What is the InChIKey of azane;2-methyloctadecane?
The InChIKey is ISYAHSXSKGMDFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H40.H3N/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2)3;/h19H,4-18H2,1-3H3;1H3.
What are the key properties of azane;2-methyloctadecane?
azane;2-methyloctadecane has a molecular weight of 285.56 g/mol, XLogP of 7.68, 15 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-methyloctadecane is sourced from PubChem (CID 175414560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).