About 2-methylnonane;heptahydrofluoride
2-methylnonane;heptahydrofluoride (PubChem CID 160801749) has the molecular formula C10H29F7
and a molecular weight of 282.33 g/mol. Its IUPAC name is 2-methylnonane;heptahydrofluoride.
Molecular Properties
| Compound Name | 2-methylnonane;heptahydrofluoride |
| PubChem CID | 160801749 |
| Molecular Formula | C10H29F7 |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | 2-methylnonane;heptahydrofluoride |
| SMILES | CCCCCCCC(C)C.F.F.F.F.F.F.F |
| InChI | InChI=1S/C10H22.7FH/c1-4-5-6-7-8-9-10(2)3;;;;;;;/h10H,4-9H2,1-3H3;7*1H |
| InChIKey | XUTWGRCLVUEEAL-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methylnonane;heptahydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylnonane;heptahydrofluoride?
The IUPAC name of 2-methylnonane;heptahydrofluoride (CID 160801749) is 2-methylnonane;heptahydrofluoride.
What is the SMILES notation for 2-methylnonane;heptahydrofluoride?
The canonical SMILES for 2-methylnonane;heptahydrofluoride is CCCCCCCC(C)C.F.F.F.F.F.F.F.
What is the InChIKey of 2-methylnonane;heptahydrofluoride?
The InChIKey is XUTWGRCLVUEEAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22.7FH/c1-4-5-6-7-8-9-10(2)3;;;;;;;/h10H,4-9H2,1-3H3;7*1H.
What are the key properties of 2-methylnonane;heptahydrofluoride?
2-methylnonane;heptahydrofluoride has a molecular weight of 282.33 g/mol, XLogP of 5.07, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylnonane;heptahydrofluoride is sourced from PubChem (CID 160801749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).