About ethane;2-methyloctane;pentane
ethane;2-methyloctane;pentane (PubChem CID 144527652) has the molecular formula C22H56
and a molecular weight of 320.69 g/mol. Its IUPAC name is ethane;2-methyloctane;pentane.
Molecular Properties
| Compound Name | ethane;2-methyloctane;pentane |
| PubChem CID | 144527652 |
| Molecular Formula | C22H56 |
| Molecular Weight | 320.69 g/mol |
| Exact Mass | 320.44 |
| IUPAC Name | ethane;2-methyloctane;pentane |
| SMILES | CC.CC.CC.CC.CCCCC.CCCCCCC(C)C |
| InChI | InChI=1S/C9H20.C5H12.4C2H6/c1-4-5-6-7-8-9(2)3;1-3-5-4-2;4*1-2/h9H,4-8H2,1-3H3;3-5H2,1-2H3;4*1-2H3 |
| InChIKey | UJVZNHQFWUOVOZ-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.69 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methyloctane;pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyloctane;pentane?
The IUPAC name of ethane;2-methyloctane;pentane (CID 144527652) is ethane;2-methyloctane;pentane.
What is the SMILES notation for ethane;2-methyloctane;pentane?
The canonical SMILES for ethane;2-methyloctane;pentane is CC.CC.CC.CC.CCCCC.CCCCCCC(C)C.
What is the InChIKey of ethane;2-methyloctane;pentane?
The InChIKey is UJVZNHQFWUOVOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20.C5H12.4C2H6/c1-4-5-6-7-8-9(2)3;1-3-5-4-2;4*1-2/h9H,4-8H2,1-3H3;3-5H2,1-2H3;4*1-2H3.
What are the key properties of ethane;2-methyloctane;pentane?
ethane;2-methyloctane;pentane has a molecular weight of 320.69 g/mol, XLogP of 9.91, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyloctane;pentane is sourced from PubChem (CID 144527652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).