About methane;2-methylicosane
methane;2-methylicosane (PubChem CID 157337652) has the molecular formula C22H48
and a molecular weight of 312.63 g/mol. Its IUPAC name is methane;2-methylicosane.
Molecular Properties
| Compound Name | methane;2-methylicosane |
| PubChem CID | 157337652 |
| Molecular Formula | C22H48 |
| Molecular Weight | 312.63 g/mol |
| Exact Mass | 312.38 |
| IUPAC Name | methane;2-methylicosane |
| SMILES | C.CCCCCCCCCCCCCCCCCCC(C)C |
| InChI | InChI=1S/C21H44.CH4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(2)3;/h21H,4-20H2,1-3H3;1H4 |
| InChIKey | BGAGUHUGVFTUDM-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.63 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methane;2-methylicosane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-methylicosane?
The IUPAC name of methane;2-methylicosane (CID 157337652) is methane;2-methylicosane.
What is the SMILES notation for methane;2-methylicosane?
The canonical SMILES for methane;2-methylicosane is C.CCCCCCCCCCCCCCCCCCC(C)C.
What is the InChIKey of methane;2-methylicosane?
The InChIKey is BGAGUHUGVFTUDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H44.CH4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(2)3;/h21H,4-20H2,1-3H3;1H4.
What are the key properties of methane;2-methylicosane?
methane;2-methylicosane has a molecular weight of 312.63 g/mol, XLogP of 8.93, 17 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-methylicosane is sourced from PubChem (CID 157337652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).