About 2-methylhexane;hydrochloride
2-methylhexane;hydrochloride (PubChem CID 172797630) has the molecular formula C7H17Cl
and a molecular weight of 136.67 g/mol. Its IUPAC name is 2-methylhexane;hydrochloride.
Molecular Properties
| Compound Name | 2-methylhexane;hydrochloride |
| PubChem CID | 172797630 |
| Molecular Formula | C7H17Cl |
| Molecular Weight | 136.67 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 2-methylhexane;hydrochloride |
| SMILES | CCCCC(C)C.Cl |
| InChI | InChI=1S/C7H16.ClH/c1-4-5-6-7(2)3;/h7H,4-6H2,1-3H3;1H |
| InChIKey | QKSIXGRSPOWONW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.67 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-methylhexane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylhexane;hydrochloride?
The IUPAC name of 2-methylhexane;hydrochloride (CID 172797630) is 2-methylhexane;hydrochloride.
What is the SMILES notation for 2-methylhexane;hydrochloride?
The canonical SMILES for 2-methylhexane;hydrochloride is CCCCC(C)C.Cl.
What is the InChIKey of 2-methylhexane;hydrochloride?
The InChIKey is QKSIXGRSPOWONW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16.ClH/c1-4-5-6-7(2)3;/h7H,4-6H2,1-3H3;1H.
What are the key properties of 2-methylhexane;hydrochloride?
2-methylhexane;hydrochloride has a molecular weight of 136.67 g/mol, XLogP of 3.25, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylhexane;hydrochloride is sourced from PubChem (CID 172797630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).