About 2-methylhexane;dihydrate
2-methylhexane;dihydrate (PubChem CID 155319003) has the molecular formula C7H20O2
and a molecular weight of 136.24 g/mol. Its IUPAC name is 2-methylhexane;dihydrate.
Molecular Properties
| Compound Name | 2-methylhexane;dihydrate |
| PubChem CID | 155319003 |
| Molecular Formula | C7H20O2 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.15 |
| IUPAC Name | 2-methylhexane;dihydrate |
| SMILES | CCCCC(C)C.O.O |
| InChI | InChI=1S/C7H16.2H2O/c1-4-5-6-7(2)3;;/h7H,4-6H2,1-3H3;2*1H2 |
| InChIKey | OBIUZIVSMPNSPR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 63.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-methylhexane;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylhexane;dihydrate?
The IUPAC name of 2-methylhexane;dihydrate (CID 155319003) is 2-methylhexane;dihydrate.
What is the SMILES notation for 2-methylhexane;dihydrate?
The canonical SMILES for 2-methylhexane;dihydrate is CCCCC(C)C.O.O.
What is the InChIKey of 2-methylhexane;dihydrate?
The InChIKey is OBIUZIVSMPNSPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16.2H2O/c1-4-5-6-7(2)3;;/h7H,4-6H2,1-3H3;2*1H2.
What are the key properties of 2-methylhexane;dihydrate?
2-methylhexane;dihydrate has a molecular weight of 136.24 g/mol, XLogP of 1.18, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylhexane;dihydrate is sourced from PubChem (CID 155319003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).