About ethane;2-methylhexane;propane
ethane;2-methylhexane;propane (PubChem CID 144516512) has the molecular formula C12H30
and a molecular weight of 174.37 g/mol. Its IUPAC name is ethane;2-methylhexane;propane.
Molecular Properties
| Compound Name | ethane;2-methylhexane;propane |
| PubChem CID | 144516512 |
| Molecular Formula | C12H30 |
| Molecular Weight | 174.37 g/mol |
| Exact Mass | 174.23 |
| IUPAC Name | ethane;2-methylhexane;propane |
| SMILES | CC.CCC.CCCCC(C)C |
| InChI | InChI=1S/C7H16.C3H8.C2H6/c1-4-5-6-7(2)3;1-3-2;1-2/h7H,4-6H2,1-3H3;3H2,1-2H3;1-2H3 |
| InChIKey | RQNRRADLAXOHNV-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 174.37 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;2-methylhexane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylhexane;propane?
The IUPAC name of ethane;2-methylhexane;propane (CID 144516512) is ethane;2-methylhexane;propane.
What is the SMILES notation for ethane;2-methylhexane;propane?
The canonical SMILES for ethane;2-methylhexane;propane is CC.CCC.CCCCC(C)C.
What is the InChIKey of ethane;2-methylhexane;propane?
The InChIKey is RQNRRADLAXOHNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16.C3H8.C2H6/c1-4-5-6-7(2)3;1-3-2;1-2/h7H,4-6H2,1-3H3;3H2,1-2H3;1-2H3.
What are the key properties of ethane;2-methylhexane;propane?
ethane;2-methylhexane;propane has a molecular weight of 174.37 g/mol, XLogP of 5.28, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylhexane;propane is sourced from PubChem (CID 144516512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).