About 2-methylhexane;propane
2-methylhexane;propane (PubChem CID 143695748) has the molecular formula C10H24
and a molecular weight of 144.30 g/mol. Its IUPAC name is 2-methylhexane;propane.
Molecular Properties
| Compound Name | 2-methylhexane;propane |
| PubChem CID | 143695748 |
| Molecular Formula | C10H24 |
| Molecular Weight | 144.30 g/mol |
| Exact Mass | 144.19 |
| IUPAC Name | 2-methylhexane;propane |
| SMILES | CCC.CCCCC(C)C |
| InChI | InChI=1S/C7H16.C3H8/c1-4-5-6-7(2)3;1-3-2/h7H,4-6H2,1-3H3;3H2,1-2H3 |
| InChIKey | PBKNWXHVUGDTPM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.30 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-methylhexane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylhexane;propane?
The IUPAC name of 2-methylhexane;propane (CID 143695748) is 2-methylhexane;propane.
What is the SMILES notation for 2-methylhexane;propane?
The canonical SMILES for 2-methylhexane;propane is CCC.CCCCC(C)C.
What is the InChIKey of 2-methylhexane;propane?
The InChIKey is PBKNWXHVUGDTPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16.C3H8/c1-4-5-6-7(2)3;1-3-2/h7H,4-6H2,1-3H3;3H2,1-2H3.
What are the key properties of 2-methylhexane;propane?
2-methylhexane;propane has a molecular weight of 144.30 g/mol, XLogP of 4.25, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylhexane;propane is sourced from PubChem (CID 143695748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).