About 3-methylhexane;3-methylpentane;pentane
3-methylhexane;3-methylpentane;pentane (PubChem CID 158601477) has the molecular formula C18H42
and a molecular weight of 258.53 g/mol. Its IUPAC name is 3-methylhexane;3-methylpentane;pentane.
Molecular Properties
| Compound Name | 3-methylhexane;3-methylpentane;pentane |
| PubChem CID | 158601477 |
| Molecular Formula | C18H42 |
| Molecular Weight | 258.53 g/mol |
| Exact Mass | 258.33 |
| IUPAC Name | 3-methylhexane;3-methylpentane;pentane |
| SMILES | CCC(C)CC.CCCC(C)CC.CCCCC |
| InChI | InChI=1S/C7H16.C6H14.C5H12/c1-4-6-7(3)5-2;1-4-6(3)5-2;1-3-5-4-2/h7H,4-6H2,1-3H3;6H,4-5H2,1-3H3;3-5H2,1-2H3 |
| InChIKey | HVRNWCICFGRPBJ-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 258.53 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-methylhexane;3-methylpentane;pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylhexane;3-methylpentane;pentane?
The IUPAC name of 3-methylhexane;3-methylpentane;pentane (CID 158601477) is 3-methylhexane;3-methylpentane;pentane.
What is the SMILES notation for 3-methylhexane;3-methylpentane;pentane?
The canonical SMILES for 3-methylhexane;3-methylpentane;pentane is CCC(C)CC.CCCC(C)CC.CCCCC.
What is the InChIKey of 3-methylhexane;3-methylpentane;pentane?
The InChIKey is HVRNWCICFGRPBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16.C6H14.C5H12/c1-4-6-7(3)5-2;1-4-6(3)5-2;1-3-5-4-2/h7H,4-6H2,1-3H3;6H,4-5H2,1-3H3;3-5H2,1-2H3.
What are the key properties of 3-methylhexane;3-methylpentane;pentane?
3-methylhexane;3-methylpentane;pentane has a molecular weight of 258.53 g/mol, XLogP of 7.47, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylhexane;3-methylpentane;pentane is sourced from PubChem (CID 158601477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).