About N,N-dimethylmethanamine;3-methylhexane
N,N-dimethylmethanamine;3-methylhexane (PubChem CID 156791587) has the molecular formula C10H25N
and a molecular weight of 159.32 g/mol. Its IUPAC name is N,N-dimethylmethanamine;3-methylhexane.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;3-methylhexane |
| PubChem CID | 156791587 |
| Molecular Formula | C10H25N |
| Molecular Weight | 159.32 g/mol |
| Exact Mass | 159.20 |
| IUPAC Name | N,N-dimethylmethanamine;3-methylhexane |
| SMILES | CCCC(C)CC.CN(C)C |
| InChI | InChI=1S/C7H16.C3H9N/c1-4-6-7(3)5-2;1-4(2)3/h7H,4-6H2,1-3H3;1-3H3 |
| InChIKey | RARLJYATHULGJV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dimethylmethanamine;3-methylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;3-methylhexane?
The IUPAC name of N,N-dimethylmethanamine;3-methylhexane (CID 156791587) is N,N-dimethylmethanamine;3-methylhexane.
What is the SMILES notation for N,N-dimethylmethanamine;3-methylhexane?
The canonical SMILES for N,N-dimethylmethanamine;3-methylhexane is CCCC(C)CC.CN(C)C.
What is the InChIKey of N,N-dimethylmethanamine;3-methylhexane?
The InChIKey is RARLJYATHULGJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16.C3H9N/c1-4-6-7(3)5-2;1-4(2)3/h7H,4-6H2,1-3H3;1-3H3.
What are the key properties of N,N-dimethylmethanamine;3-methylhexane?
N,N-dimethylmethanamine;3-methylhexane has a molecular weight of 159.32 g/mol, XLogP of 3.01, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;3-methylhexane is sourced from PubChem (CID 156791587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).