C16H34 — CID 91047062
3,5,7,9-tetramethyldodecane (PubChem CID 91047062) has the molecular formula C16H34 and a molecular weight of 226.45 g/mol. Its IUPAC name is 3,5,7,9-tetramethyldodecane.
| Compound Name | 3,5,7,9-tetramethyldodecane |
|---|---|
| PubChem CID | 91047062 |
| Molecular Formula | C16H34 |
| Molecular Weight | 226.45 g/mol |
| Exact Mass | 226.27 |
| IUPAC Name | 3,5,7,9-tetramethyldodecane |
| SMILES | CCCC(C)CC(C)CC(C)CC(C)CC |
| InChI | InChI=1S/C16H34/c1-7-9-14(4)11-16(6)12-15(5)10-13(3)8-2/h13-16H,7-12H2,1-6H3 |
| InChIKey | KNPHFQOZWKBRNH-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.45 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |