C15H31I — CID 56970315
(2R,4S,6R,8S)-1-iodo-2,4,6,8-tetramethylundecane (PubChem CID 56970315) has the molecular formula C15H31I and a molecular weight of 338.32 g/mol. Its IUPAC name is (2R,4S,6R,8S)-1-iodo-2,4,6,8-tetramethylundecane.
| Compound Name | (2R,4S,6R,8S)-1-iodo-2,4,6,8-tetramethylundecane |
|---|---|
| PubChem CID | 56970315 |
| Molecular Formula | C15H31I |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (2R,4S,6R,8S)-1-iodo-2,4,6,8-tetramethylundecane |
| SMILES | CCC[C@H](C)C[C@@H](C)C[C@H](C)C[C@@H](C)CI |
| InChI | InChI=1S/C15H31I/c1-6-7-12(2)8-13(3)9-14(4)10-15(5)11-16/h12-15H,6-11H2,1-5H3/t12-,13+,14-,15+/m0/s1 |
| InChIKey | XRRCCPMPIMTERM-LJISPDSOSA-N |
| XLogP | 5.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|