C9H19I — CID 10848517
(2S,4R)-1-iodo-2,4-dimethylheptane (PubChem CID 10848517) has the molecular formula C9H19I and a molecular weight of 254.15 g/mol. Its IUPAC name is (2S,4R)-1-iodo-2,4-dimethylheptane.
| Compound Name | (2S,4R)-1-iodo-2,4-dimethylheptane |
|---|---|
| PubChem CID | 10848517 |
| Molecular Formula | C9H19I |
| Molecular Weight | 254.15 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | (2S,4R)-1-iodo-2,4-dimethylheptane |
| SMILES | CCC[C@@H](C)C[C@H](C)CI |
| InChI | InChI=1S/C9H19I/c1-4-5-8(2)6-9(3)7-10/h8-9H,4-7H2,1-3H3/t8-,9+/m1/s1 |
| InChIKey | PATZMACRCJNKEK-BDAKNGLRSA-N |
| XLogP | 3.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.15 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|