C14H30 — CID 162976966
(4R,6S)-4,6-dimethyldodecane (PubChem CID 162976966) has the molecular formula C14H30 and a molecular weight of 198.39 g/mol. Its IUPAC name is (4R,6S)-4,6-dimethyldodecane.
| Compound Name | (4R,6S)-4,6-dimethyldodecane |
|---|---|
| PubChem CID | 162976966 |
| Molecular Formula | C14H30 |
| Molecular Weight | 198.39 g/mol |
| Exact Mass | 198.23 |
| IUPAC Name | (4R,6S)-4,6-dimethyldodecane |
| SMILES | CCCCCC[C@H](C)C[C@H](C)CCC |
| InChI | InChI=1S/C14H30/c1-5-7-8-9-11-14(4)12-13(3)10-6-2/h13-14H,5-12H2,1-4H3/t13-,14+/m1/s1 |
| InChIKey | FNUQJWPIADDMRS-KGLIPLIRSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.39 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|