C60H126 — CID 161458524
3,9-dimethylnonadecane;hexadecane;3,15,17-trimethylicosane (PubChem CID 161458524) has the molecular formula C60H126 and a molecular weight of 847.67 g/mol. Its IUPAC name is 3,9-dimethylnonadecane;hexadecane;3,15,17-trimethylicosane.
| Compound Name | 3,9-dimethylnonadecane;hexadecane;3,15,17-trimethylicosane |
|---|---|
| PubChem CID | 161458524 |
| Molecular Formula | C60H126 |
| Molecular Weight | 847.67 g/mol |
| Exact Mass | 846.99 |
| IUPAC Name | 3,9-dimethylnonadecane;hexadecane;3,15,17-trimethylicosane |
| SMILES | CCCC(C)CC(C)CCCCCCCCCCCC(C)CC.CCCCCCCCCCC(C)CCCCCC(C)CC.CCCCCCCCCCCCCCCC |
| InChI | InChI=1S/C23H48.C21H44.C16H34/c1-6-17-22(4)20-23(5)19-16-14-12-10-8-9-11-13-15-18-21(3)7-2;1-5-7-8-9-10-11-12-14-18-21(4)19-16-13-15-17-20(3)6-2;1-3-5-7-9-11-13-15-16-14-12-10-8-6-4-2/h21-23H,6-20H2,1-5H3;20-21H,5-19H2,1-4H3;3-16H2,1-2H3 |
| InChIKey | WBMGVCVCSXWZBQ-UHFFFAOYSA-N |
| XLogP | 23.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 46 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.67 |
| LogP ≤ 5 | 23.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|