C25H52 — CID 20645188
3,5,7,9,11,13,15-heptamethyloctadecane (PubChem CID 20645188) has the molecular formula C25H52 and a molecular weight of 352.69 g/mol. Its IUPAC name is 3,5,7,9,11,13,15-heptamethyloctadecane.
| Compound Name | 3,5,7,9,11,13,15-heptamethyloctadecane |
|---|---|
| PubChem CID | 20645188 |
| Molecular Formula | C25H52 |
| Molecular Weight | 352.69 g/mol |
| Exact Mass | 352.41 |
| IUPAC Name | 3,5,7,9,11,13,15-heptamethyloctadecane |
| SMILES | CCCC(C)CC(C)CC(C)CC(C)CC(C)CC(C)CC(C)CC |
| InChI | InChI=1S/C25H52/c1-10-12-20(4)14-22(6)16-24(8)18-25(9)17-23(7)15-21(5)13-19(3)11-2/h19-25H,10-18H2,1-9H3 |
| InChIKey | PCZJSKOUPSNAMM-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.69 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |