About 3,5-dimethylheptane;ethane
3,5-dimethylheptane;ethane (PubChem CID 172617343) has the molecular formula C13H32
and a molecular weight of 188.40 g/mol. Its IUPAC name is 3,5-dimethylheptane;ethane.
Molecular Properties
| Compound Name | 3,5-dimethylheptane;ethane |
| PubChem CID | 172617343 |
| Molecular Formula | C13H32 |
| Molecular Weight | 188.40 g/mol |
| Exact Mass | 188.25 |
| IUPAC Name | 3,5-dimethylheptane;ethane |
| SMILES | CC.CC.CCC(C)CC(C)CC |
| InChI | InChI=1S/C9H20.2C2H6/c1-5-8(3)7-9(4)6-2;2*1-2/h8-9H,5-7H2,1-4H3;2*1-2H3 |
| InChIKey | OAZFCJBSOXZRMO-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 188.40 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3,5-dimethylheptane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethylheptane;ethane?
The IUPAC name of 3,5-dimethylheptane;ethane (CID 172617343) is 3,5-dimethylheptane;ethane.
What is the SMILES notation for 3,5-dimethylheptane;ethane?
The canonical SMILES for 3,5-dimethylheptane;ethane is CC.CC.CCC(C)CC(C)CC.
What is the InChIKey of 3,5-dimethylheptane;ethane?
The InChIKey is OAZFCJBSOXZRMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20.2C2H6/c1-5-8(3)7-9(4)6-2;2*1-2/h8-9H,5-7H2,1-4H3;2*1-2H3.
What are the key properties of 3,5-dimethylheptane;ethane?
3,5-dimethylheptane;ethane has a molecular weight of 188.40 g/mol, XLogP of 5.52, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethylheptane;ethane is sourced from PubChem (CID 172617343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).