About (4S)-2,4-dimethylhexane
(4S)-2,4-dimethylhexane (PubChem CID 22810193) has the molecular formula C8H18
and a molecular weight of 114.23 g/mol. Its IUPAC name is (4S)-2,4-dimethylhexane.
Molecular Properties
| Compound Name | (4S)-2,4-dimethylhexane |
| PubChem CID | 22810193 |
| Molecular Formula | C8H18 |
| Molecular Weight | 114.23 g/mol |
| Exact Mass | 114.14 |
| IUPAC Name | (4S)-2,4-dimethylhexane |
| SMILES | CC[C@H](C)CC(C)C |
| InChI | InChI=1S/C8H18/c1-5-8(4)6-7(2)3/h7-8H,5-6H2,1-4H3/t8-/m0/s1 |
| InChIKey | HDGQICNBXPAKLR-QMMMGPOBSA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.23 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (4S)-2,4-dimethylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2,4-dimethylhexane?
The IUPAC name of (4S)-2,4-dimethylhexane (CID 22810193) is (4S)-2,4-dimethylhexane.
What is the SMILES notation for (4S)-2,4-dimethylhexane?
The canonical SMILES for (4S)-2,4-dimethylhexane is CC[C@H](C)CC(C)C.
What is the InChIKey of (4S)-2,4-dimethylhexane?
The InChIKey is HDGQICNBXPAKLR-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H18/c1-5-8(4)6-7(2)3/h7-8H,5-6H2,1-4H3/t8-/m0/s1.
What are the key properties of (4S)-2,4-dimethylhexane?
(4S)-2,4-dimethylhexane has a molecular weight of 114.23 g/mol, XLogP of 3.08, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2,4-dimethylhexane is sourced from PubChem (CID 22810193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).