About 2,4-dimethylhexane;hexane
2,4-dimethylhexane;hexane (PubChem CID 174686373) has the molecular formula C14H32
and a molecular weight of 200.41 g/mol. Its IUPAC name is 2,4-dimethylhexane;hexane.
Molecular Properties
| Compound Name | 2,4-dimethylhexane;hexane |
| PubChem CID | 174686373 |
| Molecular Formula | C14H32 |
| Molecular Weight | 200.41 g/mol |
| Exact Mass | 200.25 |
| IUPAC Name | 2,4-dimethylhexane;hexane |
| SMILES | CCC(C)CC(C)C.CCCCCC |
| InChI | InChI=1S/C8H18.C6H14/c1-5-8(4)6-7(2)3;1-3-5-6-4-2/h7-8H,5-6H2,1-4H3;3-6H2,1-2H3 |
| InChIKey | QFTIBNSHNMGBAB-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 200.41 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethylhexane;hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylhexane;hexane?
The IUPAC name of 2,4-dimethylhexane;hexane (CID 174686373) is 2,4-dimethylhexane;hexane.
What is the SMILES notation for 2,4-dimethylhexane;hexane?
The canonical SMILES for 2,4-dimethylhexane;hexane is CCC(C)CC(C)C.CCCCCC.
What is the InChIKey of 2,4-dimethylhexane;hexane?
The InChIKey is QFTIBNSHNMGBAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18.C6H14/c1-5-8(4)6-7(2)3;1-3-5-6-4-2/h7-8H,5-6H2,1-4H3;3-6H2,1-2H3.
What are the key properties of 2,4-dimethylhexane;hexane?
2,4-dimethylhexane;hexane has a molecular weight of 200.41 g/mol, XLogP of 5.67, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylhexane;hexane is sourced from PubChem (CID 174686373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).