C12H28 — CID 161023213
2,4-dimethylpentane;pentane (PubChem CID 161023213) has the molecular formula C12H28 and a molecular weight of 172.36 g/mol. Its IUPAC name is 2,4-dimethylpentane;pentane.
| Compound Name | 2,4-dimethylpentane;pentane |
|---|---|
| PubChem CID | 161023213 |
| Molecular Formula | C12H28 |
| Molecular Weight | 172.36 g/mol |
| Exact Mass | 172.22 |
| IUPAC Name | 2,4-dimethylpentane;pentane |
| SMILES | CC(C)CC(C)C.CCCCC |
| InChI | InChI=1S/C7H16.C5H12/c1-6(2)5-7(3)4;1-3-5-4-2/h6-7H,5H2,1-4H3;3-5H2,1-2H3 |
| InChIKey | TYQLCAIZXPZVAZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.36 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |