C10H28 — CID 159476318
2,4-dimethylpentane;methane (PubChem CID 159476318) has the molecular formula C10H28 and a molecular weight of 148.33 g/mol. Its IUPAC name is 2,4-dimethylpentane;methane.
| Compound Name | 2,4-dimethylpentane;methane |
|---|---|
| PubChem CID | 159476318 |
| Molecular Formula | C10H28 |
| Molecular Weight | 148.33 g/mol |
| Exact Mass | 148.22 |
| IUPAC Name | 2,4-dimethylpentane;methane |
| SMILES | C.C.C.CC(C)CC(C)C |
| InChI | InChI=1S/C7H16.3CH4/c1-6(2)5-7(3)4;;;/h6-7H,5H2,1-4H3;3*1H4 |
| InChIKey | LWKRNZRUVGBSPQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.33 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |