C12H24 — CID 144531255
acetylene;2,4,6-trimethylheptane (PubChem CID 144531255) has the molecular formula C12H24 and a molecular weight of 168.32 g/mol. Its IUPAC name is acetylene;2,4,6-trimethylheptane.
| Compound Name | acetylene;2,4,6-trimethylheptane |
|---|---|
| PubChem CID | 144531255 |
| Molecular Formula | C12H24 |
| Molecular Weight | 168.32 g/mol |
| Exact Mass | 168.19 |
| IUPAC Name | acetylene;2,4,6-trimethylheptane |
| SMILES | C#C.CC(C)CC(C)CC(C)C |
| InChI | InChI=1S/C10H22.C2H2/c1-8(2)6-10(5)7-9(3)4;1-2/h8-10H,6-7H2,1-5H3;1-2H |
| InChIKey | YAYKTYDYLPAYRA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.32 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|