C16H38 — CID 165013878
propane;2,4,6-trimethylheptane (PubChem CID 165013878) has the molecular formula C16H38 and a molecular weight of 230.48 g/mol. Its IUPAC name is propane;2,4,6-trimethylheptane.
| Compound Name | propane;2,4,6-trimethylheptane |
|---|---|
| PubChem CID | 165013878 |
| Molecular Formula | C16H38 |
| Molecular Weight | 230.48 g/mol |
| Exact Mass | 230.30 |
| IUPAC Name | propane;2,4,6-trimethylheptane |
| SMILES | CC(C)CC(C)CC(C)C.CCC.CCC |
| InChI | InChI=1S/C10H22.2C3H8/c1-8(2)6-10(5)7-9(3)4;2*1-3-2/h8-10H,6-7H2,1-5H3;2*3H2,1-2H3 |
| InChIKey | KCNQPSQMNKGAOH-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.48 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |