About (4R)-2,4-dimethylhexane;methane
(4R)-2,4-dimethylhexane;methane (PubChem CID 157133469) has the molecular formula C9H22
and a molecular weight of 130.28 g/mol. Its IUPAC name is (4R)-2,4-dimethylhexane;methane.
Molecular Properties
| Compound Name | (4R)-2,4-dimethylhexane;methane |
| PubChem CID | 157133469 |
| Molecular Formula | C9H22 |
| Molecular Weight | 130.28 g/mol |
| Exact Mass | 130.17 |
| IUPAC Name | (4R)-2,4-dimethylhexane;methane |
| SMILES | C.CC[C@@H](C)CC(C)C |
| InChI | InChI=1S/C8H18.CH4/c1-5-8(4)6-7(2)3;/h7-8H,5-6H2,1-4H3;1H4/t8-;/m1./s1 |
| InChIKey | AJINYXMWRWMJJJ-DDWIOCJRSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.28 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (4R)-2,4-dimethylhexane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2,4-dimethylhexane;methane?
The IUPAC name of (4R)-2,4-dimethylhexane;methane (CID 157133469) is (4R)-2,4-dimethylhexane;methane.
What is the SMILES notation for (4R)-2,4-dimethylhexane;methane?
The canonical SMILES for (4R)-2,4-dimethylhexane;methane is C.CC[C@@H](C)CC(C)C.
What is the InChIKey of (4R)-2,4-dimethylhexane;methane?
The InChIKey is AJINYXMWRWMJJJ-DDWIOCJRSA-N. The full InChI is InChI=1S/C8H18.CH4/c1-5-8(4)6-7(2)3;/h7-8H,5-6H2,1-4H3;1H4/t8-;/m1./s1.
What are the key properties of (4R)-2,4-dimethylhexane;methane?
(4R)-2,4-dimethylhexane;methane has a molecular weight of 130.28 g/mol, XLogP of 3.71, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2,4-dimethylhexane;methane is sourced from PubChem (CID 157133469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).