About methane;3-methylpentane
methane;3-methylpentane (PubChem CID 157218592) has the molecular formula C12H38
and a molecular weight of 182.44 g/mol. Its IUPAC name is methane;3-methylpentane.
Molecular Properties
| Compound Name | methane;3-methylpentane |
| PubChem CID | 157218592 |
| Molecular Formula | C12H38 |
| Molecular Weight | 182.44 g/mol |
| Exact Mass | 182.30 |
| IUPAC Name | methane;3-methylpentane |
| SMILES | C.C.C.C.C.C.CCC(C)CC |
| InChI | InChI=1S/C6H14.6CH4/c1-4-6(3)5-2;;;;;;/h6H,4-5H2,1-3H3;6*1H4 |
| InChIKey | ASSFCAINXJFALD-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 182.44 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze methane;3-methylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;3-methylpentane?
The IUPAC name of methane;3-methylpentane (CID 157218592) is methane;3-methylpentane.
What is the SMILES notation for methane;3-methylpentane?
The canonical SMILES for methane;3-methylpentane is C.C.C.C.C.C.CCC(C)CC.
What is the InChIKey of methane;3-methylpentane?
The InChIKey is ASSFCAINXJFALD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14.6CH4/c1-4-6(3)5-2;;;;;;/h6H,4-5H2,1-3H3;6*1H4.
What are the key properties of methane;3-methylpentane?
methane;3-methylpentane has a molecular weight of 182.44 g/mol, XLogP of 6.26, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methane;3-methylpentane is sourced from PubChem (CID 157218592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).