About 3-methylpentane;trimethoxysilane
3-methylpentane;trimethoxysilane (PubChem CID 175171853) has the molecular formula C9H24O3Si
and a molecular weight of 208.37 g/mol. Its IUPAC name is 3-methylpentane;trimethoxysilane.
Molecular Properties
| Compound Name | 3-methylpentane;trimethoxysilane |
| PubChem CID | 175171853 |
| Molecular Formula | C9H24O3Si |
| Molecular Weight | 208.37 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 3-methylpentane;trimethoxysilane |
| SMILES | CCC(C)CC.CO[SiH](OC)OC |
| InChI | InChI=1S/C6H14.C3H10O3Si/c1-4-6(3)5-2;1-4-7(5-2)6-3/h6H,4-5H2,1-3H3;7H,1-3H3 |
| InChIKey | FQGKXGOPOOHNJN-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-methylpentane;trimethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylpentane;trimethoxysilane?
The IUPAC name of 3-methylpentane;trimethoxysilane (CID 175171853) is 3-methylpentane;trimethoxysilane.
What is the SMILES notation for 3-methylpentane;trimethoxysilane?
The canonical SMILES for 3-methylpentane;trimethoxysilane is CCC(C)CC.CO[SiH](OC)OC.
What is the InChIKey of 3-methylpentane;trimethoxysilane?
The InChIKey is FQGKXGOPOOHNJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14.C3H10O3Si/c1-4-6(3)5-2;1-4-7(5-2)6-3/h6H,4-5H2,1-3H3;7H,1-3H3.
What are the key properties of 3-methylpentane;trimethoxysilane?
3-methylpentane;trimethoxysilane has a molecular weight of 208.37 g/mol, XLogP of 2.09, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpentane;trimethoxysilane is sourced from PubChem (CID 175171853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).