About ethoxysilane;trimethoxysilane
ethoxysilane;trimethoxysilane (PubChem CID 158529825) has the molecular formula C5H18O4Si2
and a molecular weight of 198.37 g/mol. Its IUPAC name is ethoxysilane;trimethoxysilane.
Molecular Properties
| Compound Name | ethoxysilane;trimethoxysilane |
| PubChem CID | 158529825 |
| Molecular Formula | C5H18O4Si2 |
| Molecular Weight | 198.37 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | ethoxysilane;trimethoxysilane |
| SMILES | CCO[SiH3].CO[SiH](OC)OC |
| InChI | InChI=1S/C3H10O3Si.C2H8OSi/c1-4-7(5-2)6-3;1-2-3-4/h7H,1-3H3;2H2,1,4H3 |
| InChIKey | HNFNFDJXLCRPTI-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.37 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethoxysilane;trimethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxysilane;trimethoxysilane?
The IUPAC name of ethoxysilane;trimethoxysilane (CID 158529825) is ethoxysilane;trimethoxysilane.
What is the SMILES notation for ethoxysilane;trimethoxysilane?
The canonical SMILES for ethoxysilane;trimethoxysilane is CCO[SiH3].CO[SiH](OC)OC.
What is the InChIKey of ethoxysilane;trimethoxysilane?
The InChIKey is HNFNFDJXLCRPTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10O3Si.C2H8OSi/c1-4-7(5-2)6-3;1-2-3-4/h7H,1-3H3;2H2,1,4H3.
What are the key properties of ethoxysilane;trimethoxysilane?
ethoxysilane;trimethoxysilane has a molecular weight of 198.37 g/mol, XLogP of -1.05, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxysilane;trimethoxysilane is sourced from PubChem (CID 158529825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).