About fluororuthenium;trimethoxysilane
fluororuthenium;trimethoxysilane (PubChem CID 174912559) has the molecular formula C3H10FO3RuSi
and a molecular weight of 242.26 g/mol. Its IUPAC name is fluororuthenium;trimethoxysilane.
Molecular Properties
| Compound Name | fluororuthenium;trimethoxysilane |
| PubChem CID | 174912559 |
| Molecular Formula | C3H10FO3RuSi |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.94 |
| IUPAC Name | fluororuthenium;trimethoxysilane |
| SMILES | CO[SiH](OC)OC.F[Ru] |
| InChI | InChI=1S/C3H10O3Si.FH.Ru/c1-4-7(5-2)6-3;;/h7H,1-3H3;1H;/q;;+1/p-1 |
| InChIKey | SKFXWENFJJORAC-UHFFFAOYSA-M |
| XLogP | 0.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze fluororuthenium;trimethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluororuthenium;trimethoxysilane?
The IUPAC name of fluororuthenium;trimethoxysilane (CID 174912559) is fluororuthenium;trimethoxysilane.
What is the SMILES notation for fluororuthenium;trimethoxysilane?
The canonical SMILES for fluororuthenium;trimethoxysilane is CO[SiH](OC)OC.F[Ru].
What is the InChIKey of fluororuthenium;trimethoxysilane?
The InChIKey is SKFXWENFJJORAC-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H10O3Si.FH.Ru/c1-4-7(5-2)6-3;;/h7H,1-3H3;1H;/q;;+1/p-1.
What are the key properties of fluororuthenium;trimethoxysilane?
fluororuthenium;trimethoxysilane has a molecular weight of 242.26 g/mol, XLogP of 0.06, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for fluororuthenium;trimethoxysilane is sourced from PubChem (CID 174912559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).