About prop-1-ene-1-thiol;trimethoxysilane
prop-1-ene-1-thiol;trimethoxysilane (PubChem CID 161071388) has the molecular formula C6H16O3SSi
and a molecular weight of 196.34 g/mol. Its IUPAC name is prop-1-ene-1-thiol;trimethoxysilane.
Molecular Properties
| Compound Name | prop-1-ene-1-thiol;trimethoxysilane |
| PubChem CID | 161071388 |
| Molecular Formula | C6H16O3SSi |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | prop-1-ene-1-thiol;trimethoxysilane |
| SMILES | CC=CS.CO[SiH](OC)OC |
| InChI | InChI=1S/C3H10O3Si.C3H6S/c1-4-7(5-2)6-3;1-2-3-4/h7H,1-3H3;2-4H,1H3 |
| InChIKey | UERZMVLKPKHGER-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze prop-1-ene-1-thiol;trimethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-1-ene-1-thiol;trimethoxysilane?
The IUPAC name of prop-1-ene-1-thiol;trimethoxysilane (CID 161071388) is prop-1-ene-1-thiol;trimethoxysilane.
What is the SMILES notation for prop-1-ene-1-thiol;trimethoxysilane?
The canonical SMILES for prop-1-ene-1-thiol;trimethoxysilane is CC=CS.CO[SiH](OC)OC.
What is the InChIKey of prop-1-ene-1-thiol;trimethoxysilane?
The InChIKey is UERZMVLKPKHGER-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10O3Si.C3H6S/c1-4-7(5-2)6-3;1-2-3-4/h7H,1-3H3;2-4H,1H3.
What are the key properties of prop-1-ene-1-thiol;trimethoxysilane?
prop-1-ene-1-thiol;trimethoxysilane has a molecular weight of 196.34 g/mol, XLogP of 1.09, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for prop-1-ene-1-thiol;trimethoxysilane is sourced from PubChem (CID 161071388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).