About acetonitrile;trimethoxysilane
acetonitrile;trimethoxysilane (PubChem CID 158819953) has the molecular formula C5H13NO3Si
and a molecular weight of 163.25 g/mol. Its IUPAC name is acetonitrile;trimethoxysilane.
Molecular Properties
| Compound Name | acetonitrile;trimethoxysilane |
| PubChem CID | 158819953 |
| Molecular Formula | C5H13NO3Si |
| Molecular Weight | 163.25 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | acetonitrile;trimethoxysilane |
| SMILES | CC#N.CO[SiH](OC)OC |
| InChI | InChI=1S/C3H10O3Si.C2H3N/c1-4-7(5-2)6-3;1-2-3/h7H,1-3H3;1H3 |
| InChIKey | IVSWJQBKLXAHQG-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.25 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;trimethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;trimethoxysilane?
The IUPAC name of acetonitrile;trimethoxysilane (CID 158819953) is acetonitrile;trimethoxysilane.
What is the SMILES notation for acetonitrile;trimethoxysilane?
The canonical SMILES for acetonitrile;trimethoxysilane is CC#N.CO[SiH](OC)OC.
What is the InChIKey of acetonitrile;trimethoxysilane?
The InChIKey is IVSWJQBKLXAHQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10O3Si.C2H3N/c1-4-7(5-2)6-3;1-2-3/h7H,1-3H3;1H3.
What are the key properties of acetonitrile;trimethoxysilane?
acetonitrile;trimethoxysilane has a molecular weight of 163.25 g/mol, XLogP of 0.17, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;trimethoxysilane is sourced from PubChem (CID 158819953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).