About CID 162716056
CID 162716056 (PubChem CID 162716056) has the molecular formula C6H12NO3Si
and a molecular weight of 174.25 g/mol.
Molecular Properties
| Compound Name | CID 162716056 |
| PubChem CID | 162716056 |
| Molecular Formula | C6H12NO3Si |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | — |
| SMILES | CCO[Si](OCC)OCC#N |
| InChI | InChI=1S/C6H12NO3Si/c1-3-8-11(9-4-2)10-6-5-7/h3-4,6H2,1-2H3 |
| InChIKey | HDFGKDWUVPBXGJ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 162716056 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162716056?
The IUPAC name of CID 162716056 (CID 162716056) is not available.
What is the SMILES notation for CID 162716056?
The canonical SMILES for CID 162716056 is CCO[Si](OCC)OCC#N.
What is the InChIKey of CID 162716056?
The InChIKey is HDFGKDWUVPBXGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12NO3Si/c1-3-8-11(9-4-2)10-6-5-7/h3-4,6H2,1-2H3.
What are the key properties of CID 162716056?
CID 162716056 has a molecular weight of 174.25 g/mol, XLogP of 0.58, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162716056 is sourced from PubChem (CID 162716056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).