About 2-methylprop-2-enal;trimethoxysilane
2-methylprop-2-enal;trimethoxysilane (PubChem CID 174980241) has the molecular formula C7H16O4Si
and a molecular weight of 192.29 g/mol. Its IUPAC name is 2-methylprop-2-enal;trimethoxysilane.
Molecular Properties
| Compound Name | 2-methylprop-2-enal;trimethoxysilane |
| PubChem CID | 174980241 |
| Molecular Formula | C7H16O4Si |
| Molecular Weight | 192.29 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 2-methylprop-2-enal;trimethoxysilane |
| SMILES | C=C(C)C=O.CO[SiH](OC)OC |
| InChI | InChI=1S/C4H6O.C3H10O3Si/c1-4(2)3-5;1-4-7(5-2)6-3/h3H,1H2,2H3;7H,1-3H3 |
| InChIKey | UEVKSZXMIYNWPQ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.29 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enal;trimethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enal;trimethoxysilane?
The IUPAC name of 2-methylprop-2-enal;trimethoxysilane (CID 174980241) is 2-methylprop-2-enal;trimethoxysilane.
What is the SMILES notation for 2-methylprop-2-enal;trimethoxysilane?
The canonical SMILES for 2-methylprop-2-enal;trimethoxysilane is C=C(C)C=O.CO[SiH](OC)OC.
What is the InChIKey of 2-methylprop-2-enal;trimethoxysilane?
The InChIKey is UEVKSZXMIYNWPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O.C3H10O3Si/c1-4(2)3-5;1-4-7(5-2)6-3/h3H,1H2,2H3;7H,1-3H3.
What are the key properties of 2-methylprop-2-enal;trimethoxysilane?
2-methylprop-2-enal;trimethoxysilane has a molecular weight of 192.29 g/mol, XLogP of 0.40, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enal;trimethoxysilane is sourced from PubChem (CID 174980241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).