About but-2-enal;2-methylprop-2-enal
but-2-enal;2-methylprop-2-enal (PubChem CID 173455784) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is but-2-enal;2-methylprop-2-enal.
Molecular Properties
| Compound Name | but-2-enal;2-methylprop-2-enal |
| PubChem CID | 173455784 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | but-2-enal;2-methylprop-2-enal |
| SMILES | C=C(C)C=O.CC=CC=O |
| InChI | InChI=1S/2C4H6O/c1-4(2)3-5;1-2-3-4-5/h3H,1H2,2H3;2-4H,1H3 |
| InChIKey | GVFPBTSEXVWGOX-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze but-2-enal;2-methylprop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-enal;2-methylprop-2-enal?
The IUPAC name of but-2-enal;2-methylprop-2-enal (CID 173455784) is but-2-enal;2-methylprop-2-enal.
What is the SMILES notation for but-2-enal;2-methylprop-2-enal?
The canonical SMILES for but-2-enal;2-methylprop-2-enal is C=C(C)C=O.CC=CC=O.
What is the InChIKey of but-2-enal;2-methylprop-2-enal?
The InChIKey is GVFPBTSEXVWGOX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H6O/c1-4(2)3-5;1-2-3-4-5/h3H,1H2,2H3;2-4H,1H3.
What are the key properties of but-2-enal;2-methylprop-2-enal?
but-2-enal;2-methylprop-2-enal has a molecular weight of 140.18 g/mol, XLogP of 1.52, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-enal;2-methylprop-2-enal is sourced from PubChem (CID 173455784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).