About (E)-but-2-enal;methyl prop-2-enoate
(E)-but-2-enal;methyl prop-2-enoate (PubChem CID 175331415) has the molecular formula C8H12O3
and a molecular weight of 156.18 g/mol. Its IUPAC name is (E)-but-2-enal;methyl prop-2-enoate.
Molecular Properties
| Compound Name | (E)-but-2-enal;methyl prop-2-enoate |
| PubChem CID | 175331415 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | (E)-but-2-enal;methyl prop-2-enoate |
| SMILES | C/C=C/C=O.C=CC(=O)OC |
| InChI | InChI=1S/C4H6O2.C4H6O/c1-3-4(5)6-2;1-2-3-4-5/h3H,1H2,2H3;2-4H,1H3/b;3-2+ |
| InChIKey | QZEFYNNYDRLCRJ-ZPYUXNTASA-N |
| XLogP | 1.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enal;methyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enal;methyl prop-2-enoate?
The IUPAC name of (E)-but-2-enal;methyl prop-2-enoate (CID 175331415) is (E)-but-2-enal;methyl prop-2-enoate.
What is the SMILES notation for (E)-but-2-enal;methyl prop-2-enoate?
The canonical SMILES for (E)-but-2-enal;methyl prop-2-enoate is C/C=C/C=O.C=CC(=O)OC.
What is the InChIKey of (E)-but-2-enal;methyl prop-2-enoate?
The InChIKey is QZEFYNNYDRLCRJ-ZPYUXNTASA-N. The full InChI is InChI=1S/C4H6O2.C4H6O/c1-3-4(5)6-2;1-2-3-4-5/h3H,1H2,2H3;2-4H,1H3/b;3-2+.
What are the key properties of (E)-but-2-enal;methyl prop-2-enoate?
(E)-but-2-enal;methyl prop-2-enoate has a molecular weight of 156.18 g/mol, XLogP of 1.11, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enal;methyl prop-2-enoate is sourced from PubChem (CID 175331415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).