About methyl prop-2-enoate;sulfuric acid
methyl prop-2-enoate;sulfuric acid (PubChem CID 174506127) has the molecular formula C4H10O10S2
and a molecular weight of 282.25 g/mol. Its IUPAC name is methyl prop-2-enoate;sulfuric acid.
Molecular Properties
| Compound Name | methyl prop-2-enoate;sulfuric acid |
| PubChem CID | 174506127 |
| Molecular Formula | C4H10O10S2 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 281.97 |
| IUPAC Name | methyl prop-2-enoate;sulfuric acid |
| SMILES | C=CC(=O)OC.O=S(=O)(O)O.O=S(=O)(O)O |
| InChI | InChI=1S/C4H6O2.2H2O4S/c1-3-4(5)6-2;2*1-5(2,3)4/h3H,1H2,2H3;2*(H2,1,2,3,4) |
| InChIKey | KQSHWZCYJMVXJR-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 175.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methyl prop-2-enoate;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl prop-2-enoate;sulfuric acid?
The IUPAC name of methyl prop-2-enoate;sulfuric acid (CID 174506127) is methyl prop-2-enoate;sulfuric acid.
What is the SMILES notation for methyl prop-2-enoate;sulfuric acid?
The canonical SMILES for methyl prop-2-enoate;sulfuric acid is C=CC(=O)OC.O=S(=O)(O)O.O=S(=O)(O)O.
What is the InChIKey of methyl prop-2-enoate;sulfuric acid?
The InChIKey is KQSHWZCYJMVXJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.2H2O4S/c1-3-4(5)6-2;2*1-5(2,3)4/h3H,1H2,2H3;2*(H2,1,2,3,4).
What are the key properties of methyl prop-2-enoate;sulfuric acid?
methyl prop-2-enoate;sulfuric acid has a molecular weight of 282.25 g/mol, XLogP of -0.96, 1 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl prop-2-enoate;sulfuric acid is sourced from PubChem (CID 174506127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).