About dimethyltin;methyl prop-2-enoate
dimethyltin;methyl prop-2-enoate (PubChem CID 174578648) has the molecular formula C6H12O2Sn
and a molecular weight of 234.87 g/mol. Its IUPAC name is dimethyltin;methyl prop-2-enoate.
Molecular Properties
| Compound Name | dimethyltin;methyl prop-2-enoate |
| PubChem CID | 174578648 |
| Molecular Formula | C6H12O2Sn |
| Molecular Weight | 234.87 g/mol |
| Exact Mass | 235.99 |
| IUPAC Name | dimethyltin;methyl prop-2-enoate |
| SMILES | C=CC(=O)OC.C[Sn]C |
| InChI | InChI=1S/C4H6O2.2CH3.Sn/c1-3-4(5)6-2;;;/h3H,1H2,2H3;2*1H3; |
| InChIKey | IABOXNHWZDMNFS-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.87 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dimethyltin;methyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyltin;methyl prop-2-enoate?
The IUPAC name of dimethyltin;methyl prop-2-enoate (CID 174578648) is dimethyltin;methyl prop-2-enoate.
What is the SMILES notation for dimethyltin;methyl prop-2-enoate?
The canonical SMILES for dimethyltin;methyl prop-2-enoate is C=CC(=O)OC.C[Sn]C.
What is the InChIKey of dimethyltin;methyl prop-2-enoate?
The InChIKey is IABOXNHWZDMNFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.2CH3.Sn/c1-3-4(5)6-2;;;/h3H,1H2,2H3;2*1H3;.
What are the key properties of dimethyltin;methyl prop-2-enoate?
dimethyltin;methyl prop-2-enoate has a molecular weight of 234.87 g/mol, XLogP of 1.13, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyltin;methyl prop-2-enoate is sourced from PubChem (CID 174578648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).