About methyl prop-2-enoate;phosphoric acid
methyl prop-2-enoate;phosphoric acid (PubChem CID 174689976) has the molecular formula C4H12O10P2
and a molecular weight of 282.08 g/mol. Its IUPAC name is methyl prop-2-enoate;phosphoric acid.
Molecular Properties
| Compound Name | methyl prop-2-enoate;phosphoric acid |
| PubChem CID | 174689976 |
| Molecular Formula | C4H12O10P2 |
| Molecular Weight | 282.08 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | methyl prop-2-enoate;phosphoric acid |
| SMILES | C=CC(=O)OC.O=P(O)(O)O.O=P(O)(O)O |
| InChI | InChI=1S/C4H6O2.2H3O4P/c1-3-4(5)6-2;2*1-5(2,3)4/h3H,1H2,2H3;2*(H3,1,2,3,4) |
| InChIKey | HYCSMVZELMQICZ-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 181.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.08 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methyl prop-2-enoate;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl prop-2-enoate;phosphoric acid?
The IUPAC name of methyl prop-2-enoate;phosphoric acid (CID 174689976) is methyl prop-2-enoate;phosphoric acid.
What is the SMILES notation for methyl prop-2-enoate;phosphoric acid?
The canonical SMILES for methyl prop-2-enoate;phosphoric acid is C=CC(=O)OC.O=P(O)(O)O.O=P(O)(O)O.
What is the InChIKey of methyl prop-2-enoate;phosphoric acid?
The InChIKey is HYCSMVZELMQICZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.2H3O4P/c1-3-4(5)6-2;2*1-5(2,3)4/h3H,1H2,2H3;2*(H3,1,2,3,4).
What are the key properties of methyl prop-2-enoate;phosphoric acid?
methyl prop-2-enoate;phosphoric acid has a molecular weight of 282.08 g/mol, XLogP of -1.51, 1 rotatable bonds, 6 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl prop-2-enoate;phosphoric acid is sourced from PubChem (CID 174689976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).