About ethyl dihydrogen phosphate;methyl prop-2-enoate
ethyl dihydrogen phosphate;methyl prop-2-enoate (PubChem CID 158276127) has the molecular formula C6H13O6P
and a molecular weight of 212.14 g/mol. Its IUPAC name is ethyl dihydrogen phosphate;methyl prop-2-enoate.
Molecular Properties
| Compound Name | ethyl dihydrogen phosphate;methyl prop-2-enoate |
| PubChem CID | 158276127 |
| Molecular Formula | C6H13O6P |
| Molecular Weight | 212.14 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | ethyl dihydrogen phosphate;methyl prop-2-enoate |
| SMILES | C=CC(=O)OC.CCOP(=O)(O)O |
| InChI | InChI=1S/C4H6O2.C2H7O4P/c1-3-4(5)6-2;1-2-6-7(3,4)5/h3H,1H2,2H3;2H2,1H3,(H2,3,4,5) |
| InChIKey | GJPXVRWJEBGBAM-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.14 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl dihydrogen phosphate;methyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl dihydrogen phosphate;methyl prop-2-enoate?
The IUPAC name of ethyl dihydrogen phosphate;methyl prop-2-enoate (CID 158276127) is ethyl dihydrogen phosphate;methyl prop-2-enoate.
What is the SMILES notation for ethyl dihydrogen phosphate;methyl prop-2-enoate?
The canonical SMILES for ethyl dihydrogen phosphate;methyl prop-2-enoate is C=CC(=O)OC.CCOP(=O)(O)O.
What is the InChIKey of ethyl dihydrogen phosphate;methyl prop-2-enoate?
The InChIKey is GJPXVRWJEBGBAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.C2H7O4P/c1-3-4(5)6-2;1-2-6-7(3,4)5/h3H,1H2,2H3;2H2,1H3,(H2,3,4,5).
What are the key properties of ethyl dihydrogen phosphate;methyl prop-2-enoate?
ethyl dihydrogen phosphate;methyl prop-2-enoate has a molecular weight of 212.14 g/mol, XLogP of 0.46, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl dihydrogen phosphate;methyl prop-2-enoate is sourced from PubChem (CID 158276127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).