About acetic acid;2-methylprop-2-enal;propan-2-one
acetic acid;2-methylprop-2-enal;propan-2-one (PubChem CID 162217327) has the molecular formula C9H16O4
and a molecular weight of 188.22 g/mol. Its IUPAC name is acetic acid;2-methylprop-2-enal;propan-2-one.
Molecular Properties
| Compound Name | acetic acid;2-methylprop-2-enal;propan-2-one |
| PubChem CID | 162217327 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | acetic acid;2-methylprop-2-enal;propan-2-one |
| SMILES | C=C(C)C=O.CC(=O)O.CC(C)=O |
| InChI | InChI=1S/C4H6O.C3H6O.C2H4O2/c1-4(2)3-5;1-3(2)4;1-2(3)4/h3H,1H2,2H3;1-2H3;1H3,(H,3,4) |
| InChIKey | CJSIWQQZTXCYMS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;2-methylprop-2-enal;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;2-methylprop-2-enal;propan-2-one?
The IUPAC name of acetic acid;2-methylprop-2-enal;propan-2-one (CID 162217327) is acetic acid;2-methylprop-2-enal;propan-2-one.
What is the SMILES notation for acetic acid;2-methylprop-2-enal;propan-2-one?
The canonical SMILES for acetic acid;2-methylprop-2-enal;propan-2-one is C=C(C)C=O.CC(=O)O.CC(C)=O.
What is the InChIKey of acetic acid;2-methylprop-2-enal;propan-2-one?
The InChIKey is CJSIWQQZTXCYMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O.C3H6O.C2H4O2/c1-4(2)3-5;1-3(2)4;1-2(3)4/h3H,1H2,2H3;1-2H3;1H3,(H,3,4).
What are the key properties of acetic acid;2-methylprop-2-enal;propan-2-one?
acetic acid;2-methylprop-2-enal;propan-2-one has a molecular weight of 188.22 g/mol, XLogP of 1.45, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-methylprop-2-enal;propan-2-one is sourced from PubChem (CID 162217327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).