About acetic acid;iron;propan-2-one
acetic acid;iron;propan-2-one (PubChem CID 174901322) has the molecular formula C9H18FeO7
and a molecular weight of 294.08 g/mol. Its IUPAC name is acetic acid;iron;propan-2-one.
Molecular Properties
| Compound Name | acetic acid;iron;propan-2-one |
| PubChem CID | 174901322 |
| Molecular Formula | C9H18FeO7 |
| Molecular Weight | 294.08 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | acetic acid;iron;propan-2-one |
| SMILES | CC(=O)O.CC(=O)O.CC(=O)O.CC(C)=O.[Fe] |
| InChI | InChI=1S/C3H6O.3C2H4O2.Fe/c1-3(2)4;3*1-2(3)4;/h1-2H3;3*1H3,(H,3,4); |
| InChIKey | FOLHUURVYCUAFB-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.08 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;iron;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;iron;propan-2-one?
The IUPAC name of acetic acid;iron;propan-2-one (CID 174901322) is acetic acid;iron;propan-2-one.
What is the SMILES notation for acetic acid;iron;propan-2-one?
The canonical SMILES for acetic acid;iron;propan-2-one is CC(=O)O.CC(=O)O.CC(=O)O.CC(C)=O.[Fe].
What is the InChIKey of acetic acid;iron;propan-2-one?
The InChIKey is FOLHUURVYCUAFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O.3C2H4O2.Fe/c1-3(2)4;3*1-2(3)4;/h1-2H3;3*1H3,(H,3,4);.
What are the key properties of acetic acid;iron;propan-2-one?
acetic acid;iron;propan-2-one has a molecular weight of 294.08 g/mol, XLogP of 0.87, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;iron;propan-2-one is sourced from PubChem (CID 174901322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).