About acetic acid;azane;propan-2-one
acetic acid;azane;propan-2-one (PubChem CID 174728402) has the molecular formula C5H13NO3
and a molecular weight of 135.16 g/mol. Its IUPAC name is acetic acid;azane;propan-2-one.
Molecular Properties
| Compound Name | acetic acid;azane;propan-2-one |
| PubChem CID | 174728402 |
| Molecular Formula | C5H13NO3 |
| Molecular Weight | 135.16 g/mol |
| Exact Mass | 135.09 |
| IUPAC Name | acetic acid;azane;propan-2-one |
| SMILES | CC(=O)O.CC(C)=O.N |
| InChI | InChI=1S/C3H6O.C2H4O2.H3N/c1-3(2)4;1-2(3)4;/h1-2H3;1H3,(H,3,4);1H3 |
| InChIKey | UPVKGNYCABDVRG-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.16 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetic acid;azane;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;azane;propan-2-one?
The IUPAC name of acetic acid;azane;propan-2-one (CID 174728402) is acetic acid;azane;propan-2-one.
What is the SMILES notation for acetic acid;azane;propan-2-one?
The canonical SMILES for acetic acid;azane;propan-2-one is CC(=O)O.CC(C)=O.N.
What is the InChIKey of acetic acid;azane;propan-2-one?
The InChIKey is UPVKGNYCABDVRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O.C2H4O2.H3N/c1-3(2)4;1-2(3)4;/h1-2H3;1H3,(H,3,4);1H3.
What are the key properties of acetic acid;azane;propan-2-one?
acetic acid;azane;propan-2-one has a molecular weight of 135.16 g/mol, XLogP of 0.85, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;azane;propan-2-one is sourced from PubChem (CID 174728402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).