About acetic acid;azane
acetic acid;azane (PubChem CID 173340275) has the molecular formula C2H28N8O2
and a molecular weight of 196.30 g/mol. Its IUPAC name is acetic acid;azane.
Molecular Properties
| Compound Name | acetic acid;azane |
| PubChem CID | 173340275 |
| Molecular Formula | C2H28N8O2 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.23 |
| IUPAC Name | acetic acid;azane |
| SMILES | CC(=O)O.N.N.N.N.N.N.N.N |
| InChI | InChI=1S/C2H4O2.8H3N/c1-2(3)4;;;;;;;;/h1H3,(H,3,4);8*1H3 |
| InChIKey | AKPHWPJHVFWPQV-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 317.30 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze acetic acid;azane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;azane?
The IUPAC name of acetic acid;azane (CID 173340275) is acetic acid;azane.
What is the SMILES notation for acetic acid;azane?
The canonical SMILES for acetic acid;azane is CC(=O)O.N.N.N.N.N.N.N.N.
What is the InChIKey of acetic acid;azane?
The InChIKey is AKPHWPJHVFWPQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2.8H3N/c1-2(3)4;;;;;;;;/h1H3,(H,3,4);8*1H3.
What are the key properties of acetic acid;azane?
acetic acid;azane has a molecular weight of 196.30 g/mol, XLogP of 1.39, 0 rotatable bonds, 9 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;azane is sourced from PubChem (CID 173340275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).