About Tin(II)acetate
Tin(II)acetate (PubChem CID 87063833) has the molecular formula C2H4O2Sn
and a molecular weight of 178.76 g/mol.
Molecular Properties
| Compound Name | Tin(II)acetate |
| PubChem CID | 87063833 |
| Molecular Formula | C2H4O2Sn |
| Molecular Weight | 178.76 g/mol |
| Exact Mass | 179.92 |
| IUPAC Name | — |
| SMILES | CC(=O)O.[Sn] |
| InChI | InChI=1S/C2H4O2.Sn/c1-2(3)4;/h1H3,(H,3,4); |
| InChIKey | FENSZQTZBXOKBB-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.76 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze Tin(II)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tin(II)acetate?
The IUPAC name of Tin(II)acetate (CID 87063833) is not available.
What is the SMILES notation for Tin(II)acetate?
The canonical SMILES for Tin(II)acetate is CC(=O)O.[Sn].
What is the InChIKey of Tin(II)acetate?
The InChIKey is FENSZQTZBXOKBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2.Sn/c1-2(3)4;/h1H3,(H,3,4);.
What are the key properties of Tin(II)acetate?
Tin(II)acetate has a molecular weight of 178.76 g/mol, XLogP of -0.29, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Tin(II)acetate is sourced from PubChem (CID 87063833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).