About acetic acid;cobalt
acetic acid;cobalt (PubChem CID 54602348) has the molecular formula C2H4CoO2
and a molecular weight of 118.98 g/mol. Its IUPAC name is acetic acid;cobalt.
Molecular Properties
| Compound Name | acetic acid;cobalt |
| PubChem CID | 54602348 |
| Molecular Formula | C2H4CoO2 |
| Molecular Weight | 118.98 g/mol |
| Exact Mass | 118.95 |
| IUPAC Name | acetic acid;cobalt |
| SMILES | CC(=O)O.[Co] |
| InChI | InChI=1S/C2H4O2.Co/c1-2(3)4;/h1H3,(H,3,4); |
| InChIKey | SVMCDCBHSKARBQ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.98 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze acetic acid;cobalt with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;cobalt?
The IUPAC name of acetic acid;cobalt (CID 54602348) is acetic acid;cobalt.
What is the SMILES notation for acetic acid;cobalt?
The canonical SMILES for acetic acid;cobalt is CC(=O)O.[Co].
What is the InChIKey of acetic acid;cobalt?
The InChIKey is SVMCDCBHSKARBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2.Co/c1-2(3)4;/h1H3,(H,3,4);.
What are the key properties of acetic acid;cobalt?
acetic acid;cobalt has a molecular weight of 118.98 g/mol, XLogP of 0.09, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;cobalt is sourced from PubChem (CID 54602348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).