About acetic acid;iron;hydrofluoride
acetic acid;iron;hydrofluoride (PubChem CID 174806261) has the molecular formula C2H5FFeO2
and a molecular weight of 135.90 g/mol. Its IUPAC name is acetic acid;iron;hydrofluoride.
Molecular Properties
| Compound Name | acetic acid;iron;hydrofluoride |
| PubChem CID | 174806261 |
| Molecular Formula | C2H5FFeO2 |
| Molecular Weight | 135.90 g/mol |
| Exact Mass | 135.96 |
| IUPAC Name | acetic acid;iron;hydrofluoride |
| SMILES | CC(=O)O.F.[Fe] |
| InChI | InChI=1S/C2H4O2.FH.Fe/c1-2(3)4;;/h1H3,(H,3,4);1H; |
| InChIKey | IFJWGSNLOWZWKK-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.90 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;iron;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;iron;hydrofluoride?
The IUPAC name of acetic acid;iron;hydrofluoride (CID 174806261) is acetic acid;iron;hydrofluoride.
What is the SMILES notation for acetic acid;iron;hydrofluoride?
The canonical SMILES for acetic acid;iron;hydrofluoride is CC(=O)O.F.[Fe].
What is the InChIKey of acetic acid;iron;hydrofluoride?
The InChIKey is IFJWGSNLOWZWKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2.FH.Fe/c1-2(3)4;;/h1H3,(H,3,4);1H;.
What are the key properties of acetic acid;iron;hydrofluoride?
acetic acid;iron;hydrofluoride has a molecular weight of 135.90 g/mol, XLogP of 0.24, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;iron;hydrofluoride is sourced from PubChem (CID 174806261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).