C13H24O8 — CID 162329319
acetic acid;2-methylbuta-1,3-diene (PubChem CID 162329319) has the molecular formula C13H24O8 and a molecular weight of 308.33 g/mol. Its IUPAC name is acetic acid;2-methylbuta-1,3-diene.
| Compound Name | acetic acid;2-methylbuta-1,3-diene |
|---|---|
| PubChem CID | 162329319 |
| Molecular Formula | C13H24O8 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | acetic acid;2-methylbuta-1,3-diene |
| SMILES | C=CC(=C)C.CC(=O)O.CC(=O)O.CC(=O)O.CC(=O)O |
| InChI | InChI=1S/C5H8.4C2H4O2/c1-4-5(2)3;4*1-2(3)4/h4H,1-2H2,3H3;4*1H3,(H,3,4) |
| InChIKey | VTLZYFGFNZBHAR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|