About 2-methylbuta-1,3-diene;pentane-2,4-dione
2-methylbuta-1,3-diene;pentane-2,4-dione (PubChem CID 18795140) has the molecular formula C10H16O2
and a molecular weight of 168.24 g/mol. Its IUPAC name is 2-methylbuta-1,3-diene;pentane-2,4-dione.
Molecular Properties
| Compound Name | 2-methylbuta-1,3-diene;pentane-2,4-dione |
| PubChem CID | 18795140 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 2-methylbuta-1,3-diene;pentane-2,4-dione |
| SMILES | C=CC(=C)C.CC(=O)CC(C)=O |
| InChI | InChI=1S/C5H8O2.C5H8/c1-4(6)3-5(2)7;1-4-5(2)3/h3H2,1-2H3;4H,1-2H2,3H3 |
| InChIKey | HBZIHCJCTCHVFT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbuta-1,3-diene;pentane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbuta-1,3-diene;pentane-2,4-dione?
The IUPAC name of 2-methylbuta-1,3-diene;pentane-2,4-dione (CID 18795140) is 2-methylbuta-1,3-diene;pentane-2,4-dione.
What is the SMILES notation for 2-methylbuta-1,3-diene;pentane-2,4-dione?
The canonical SMILES for 2-methylbuta-1,3-diene;pentane-2,4-dione is C=CC(=C)C.CC(=O)CC(C)=O.
What is the InChIKey of 2-methylbuta-1,3-diene;pentane-2,4-dione?
The InChIKey is HBZIHCJCTCHVFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.C5H8/c1-4(6)3-5(2)7;1-4-5(2)3/h3H2,1-2H3;4H,1-2H2,3H3.
What are the key properties of 2-methylbuta-1,3-diene;pentane-2,4-dione?
2-methylbuta-1,3-diene;pentane-2,4-dione has a molecular weight of 168.24 g/mol, XLogP of 2.30, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbuta-1,3-diene;pentane-2,4-dione is sourced from PubChem (CID 18795140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).