About Lithium pentane-2,4-dione
Lithium pentane-2,4-dione (PubChem CID 86735745) has the molecular formula C5H8LiO2
and a molecular weight of 107.06 g/mol.
Molecular Properties
| Compound Name | Lithium pentane-2,4-dione |
| PubChem CID | 86735745 |
| Molecular Formula | C5H8LiO2 |
| Molecular Weight | 107.06 g/mol |
| Exact Mass | 107.07 |
| IUPAC Name | — |
| SMILES | CC(=O)CC(C)=O.[Li] |
| InChI | InChI=1S/C5H8O2.Li/c1-4(6)3-5(2)7;/h3H2,1-2H3; |
| InChIKey | ZADRSPBLAQBZEC-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.06 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze Lithium pentane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Lithium pentane-2,4-dione?
The IUPAC name of Lithium pentane-2,4-dione (CID 86735745) is not available.
What is the SMILES notation for Lithium pentane-2,4-dione?
The canonical SMILES for Lithium pentane-2,4-dione is CC(=O)CC(C)=O.[Li].
What is the InChIKey of Lithium pentane-2,4-dione?
The InChIKey is ZADRSPBLAQBZEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.Li/c1-4(6)3-5(2)7;/h3H2,1-2H3;.
What are the key properties of Lithium pentane-2,4-dione?
Lithium pentane-2,4-dione has a molecular weight of 107.06 g/mol, XLogP of 0.17, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Lithium pentane-2,4-dione is sourced from PubChem (CID 86735745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).